4,10-Dimethylidene-7-(propan-2-yl)cyclodec-5-en-1-ol
| Internal ID | fff76338-c979-4357-8785-e12ff4ff1dd7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Germacrane sesquiterpenoids |
| IUPAC Name | 4,10-dimethylidene-7-propan-2-ylcyclodec-5-en-1-ol |
| SMILES (Canonical) | CC(C)C1CCC(=C)C(CCC(=C)C=C1)O |
| SMILES (Isomeric) | CC(C)C1CCC(=C)C(CCC(=C)C=C1)O |
| InChI | InChI=1S/C15H24O/c1-11(2)14-8-5-12(3)6-10-15(16)13(4)7-9-14/h5,8,11,14-16H,3-4,6-7,9-10H2,1-2H3 |
| InChI Key | OSSWBZXPRYZGRO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.182715385 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 3.70 |
| 4(15),5,10(14)-Germacratrien-1-ol |
| 4,10-Dimethylidene-7-(propan-2-yl)cyclodec-5-en-1-ol |
| 65882-79-3 |
| ent-Germacra-4(15),5,10(14)-trien-1beta-ol |
| (5Z,7S)-4,10-dimethylidene-7-propan-2-ylcyclodec-5-en-1-ol |
| DTXSID40793040 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.81% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.12% | 93.56% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.22% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.65% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.92% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.74% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.57% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.00% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.52% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.72% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.72% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.34% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 71370041 |
| LOTUS | LTS0149321 |
| wikiData | Q82762158 |