4-(3,4-Dihydroxybut-1-enyl)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one
Internal ID | 496a6684-5031-4e4e-97c8-945e50824c6b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 4-(3,4-dihydroxybut-1-enyl)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one |
SMILES (Canonical) | CC1=CC(=O)CC(C1(C=CC(CO)O)O)(C)C |
SMILES (Isomeric) | CC1=CC(=O)CC(C1(C=CC(CO)O)O)(C)C |
InChI | InChI=1S/C13H20O4/c1-9-6-11(16)7-12(2,3)13(9,17)5-4-10(15)8-14/h4-6,10,14-15,17H,7-8H2,1-3H3 |
InChI Key | CNLCQYMRNGWEJB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H20O4 |
Molecular Weight | 240.29 g/mol |
Exact Mass | 240.13615911 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | -0.50 |
929881-46-9 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.19% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 95.19% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.70% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.25% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.16% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.25% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.27% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.25% | 94.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.95% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.07% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.46% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brucea javanica |
Cucumis sativus |
PubChem | 124222269 |
LOTUS | LTS0145784 |
wikiData | Q104965946 |