(3E,4R)-4-hydroxy-5-methylidene-3-tetradecylideneoxolan-2-one
Internal ID | 0cc42370-8143-4e54-aaf2-e1cc4259ba8a |
Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
IUPAC Name | (3E,4R)-4-hydroxy-5-methylidene-3-tetradecylideneoxolan-2-one |
SMILES (Canonical) | CCCCCCCCCCCCCC=C1C(C(=C)OC1=O)O |
SMILES (Isomeric) | CCCCCCCCCCCCC/C=C/1\[C@H](C(=C)OC1=O)O |
InChI | InChI=1S/C19H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(20)16(2)22-19(17)21/h15,18,20H,2-14H2,1H3/b17-15+/t18-/m0/s1 |
InChI Key | FCLYKYQBTSMTJB-ODECOBMASA-N |
Popularity | 3 references in papers |
Molecular Formula | C19H32O3 |
Molecular Weight | 308.50 g/mol |
Exact Mass | 308.23514488 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 6.70 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.89% | 98.95% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.74% | 85.94% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.32% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.75% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.22% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.35% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.10% | 94.73% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.85% | 89.63% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.26% | 96.37% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.25% | 93.56% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.98% | 98.03% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.12% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinnamomum subavenium |
Lindera glauca |
PubChem | 154496907 |
LOTUS | LTS0072799 |
wikiData | Q104993214 |