(3E)-3-dodec-11-enylidene-4-hydroxy-5-methylideneoxolan-2-one
Internal ID | 83ad98bf-f339-426d-98f6-2b541234eff5 |
Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
IUPAC Name | (3E)-3-dodec-11-enylidene-4-hydroxy-5-methylideneoxolan-2-one |
SMILES (Canonical) | C=CCCCCCCCCCC=C1C(C(=C)OC1=O)O |
SMILES (Isomeric) | C=CCCCCCCCCC/C=C/1\C(C(=C)OC1=O)O |
InChI | InChI=1S/C17H26O3/c1-3-4-5-6-7-8-9-10-11-12-13-15-16(18)14(2)20-17(15)19/h3,13,16,18H,1-2,4-12H2/b15-13+ |
InChI Key | OFUXNQJZVMQBJO-FYWRMAATSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H26O3 |
Molecular Weight | 278.40 g/mol |
Exact Mass | 278.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1829 | O15379 | Histone deacetylase 3 | 93.52% | 95.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.17% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 91.99% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.38% | 95.56% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 86.78% | 95.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.40% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.32% | 89.67% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.68% | 93.99% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.51% | 89.34% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.24% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.15% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cinnamomum camphora |
Daphnopsis macrophylla |
Litsea coreana var. coreana |
Litsea pseudoelongata |
PubChem | 14259080 |
LOTUS | LTS0089498 |
wikiData | Q105191410 |