[(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate
Internal ID | cf146a14-bf28-451e-bf47-f312f0e5b956 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid esters |
IUPAC Name | [(2S,3R,4R,5R,6S)-4,5-dihydroxy-2-[[(1S,2S,4S,5S,6R,10S)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC=C(C=C6)OC)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]3C=CO[C@H]([C@@H]3[C@@]4([C@H]2O4)CO)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)OC(=O)/C=C/C6=CC=C(C=C6)OC)O)O |
InChI | InChI=1S/C31H40O16/c1-13-20(35)23(38)26(44-18(34)8-5-14-3-6-15(40-2)7-4-14)30(42-13)45-25-16-9-10-41-28(19(16)31(12-33)27(25)47-31)46-29-24(39)22(37)21(36)17(11-32)43-29/h3-10,13,16-17,19-30,32-33,35-39H,11-12H2,1-2H3/b8-5+/t13-,16+,17+,19+,20-,21+,22-,23+,24+,25-,26+,27-,28-,29-,30-,31+/m0/s1 |
InChI Key | LLIQKSHHYOJCRY-QVPDUFJHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H40O16 |
Molecular Weight | 668.60 g/mol |
Exact Mass | 668.23163518 g/mol |
Topological Polar Surface Area (TPSA) | 236.00 Ų |
XlogP | -1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.28% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.33% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.19% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.05% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.74% | 96.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 92.05% | 90.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.01% | 97.36% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.82% | 90.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.56% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.16% | 86.92% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.05% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.71% | 99.17% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.57% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.95% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.58% | 94.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.54% | 91.07% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.05% | 95.93% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 80.85% | 87.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Premna microphylla |
Verbascum thapsus |
PubChem | 15736671 |
LOTUS | LTS0040003 |
wikiData | Q105153530 |