(3aR,7aS)-Hexahydro-3a-hydroxy-6(2H)-benzofuranone
Internal ID | 174cfe50-85aa-4902-805c-1261ef19cbbc |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 3a-hydroxy-2,3,4,5,7,7a-hexahydro-1-benzofuran-6-one |
SMILES (Canonical) | C1CC2(CCOC2CC1=O)O |
SMILES (Isomeric) | C1CC2(CCOC2CC1=O)O |
InChI | InChI=1S/C8H12O3/c9-6-1-2-8(10)3-4-11-7(8)5-6/h7,10H,1-5H2 |
InChI Key | ZCBQZDMJIVJQLX-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C8H12O3 |
Molecular Weight | 156.18 g/mol |
Exact Mass | 156.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | -0.70 |
189264-44-6 |
(3aR,7aS)-Hexahydro-3a-hydroxy-6(2H)-benzofuranone |
3a-Hydroxyhexahydrobenzofuran-6(2H)-one |
FT-0697870 |
FT-0697894 |
1824193-65-8 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.82% | 91.11% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.82% | 85.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.27% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.27% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.85% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.79% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.28% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clerodendrum indicum |
Incarvillea mairei |
Millingtonia hortensis |
PubChem | 11412510 |
LOTUS | LTS0211136 |
wikiData | Q105370958 |