(2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one
Internal ID | 193f6333-768a-4309-83ef-839d4d02a6da |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H](C(O2)OC3=CC(=C4C(=O)C[C@H](OC4=C3)C5=CC(=C(C=C5)O)O)O)O)O)O)O)O)O |
InChI | InChI=1S/C27H32O15/c1-9-20(32)22(34)24(36)26(39-9)38-8-18-21(33)23(35)25(37)27(42-18)40-11-5-14(30)19-15(31)7-16(41-17(19)6-11)10-2-3-12(28)13(29)4-10/h2-6,9,16,18,20-30,32-37H,7-8H2,1H3/t9-,16-,18+,20-,21+,22+,23-,24+,25+,26-,27?/m0/s1 |
InChI Key | OMQADRGFMLGFJF-MWJMZSRHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H32O15 |
Molecular Weight | 596.50 g/mol |
Exact Mass | 596.17412031 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -1.40 |
There are no found synonyms. |
![2D Structure of (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one 2D Structure of (2S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/39df4660-8618-11ee-b4b4-131660abec43.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.77% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.17% | 97.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.45% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.57% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.32% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.13% | 99.15% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.46% | 90.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.30% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.54% | 94.80% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.76% | 94.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.66% | 95.89% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.56% | 97.36% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.98% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.72% | 99.23% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.56% | 92.68% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.04% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.54% | 95.93% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.44% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.96% | 86.92% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.68% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus × aurantium |
Citrus hystrix |
Mentha × piperita |
PubChem | 138454315 |
LOTUS | LTS0096238 |
wikiData | Q104391573 |