(1,2,2,14,15,16,19,20,21,35,36-Undecahydroxy-3,6,11,24,32-pentaoxo-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-29-yl) 3,4,5-trihydroxybenzoate
Internal ID | 8308166d-da28-4182-80db-9e9d37ea10b1 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | (1,2,2,14,15,16,19,20,21,35,36-undecahydroxy-3,6,11,24,32-pentaoxo-7,10,25,28,31,40-hexaoxaoctacyclo[35.2.1.05,39.08,27.09,30.012,17.018,23.033,38]tetraconta-4,12,14,16,18,20,22,33,35,37-decaen-29-yl) 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C7C(=CC(=O)C(C7(O6)O)(O)O)C(=O)O3)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C7C(=CC(=O)C(C7(O6)O)(O)O)C(=O)O3)O)O)OC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C41H28O27/c42-13-1-8(2-14(43)24(13)48)34(54)67-39-33-32-30(64-38(58)12-6-19(47)40(59,60)41(61)23(12)22-11(37(57)66-33)5-17(46)27(51)31(22)68-41)18(63-39)7-62-35(55)9-3-15(44)25(49)28(52)20(9)21-10(36(56)65-32)4-16(45)26(50)29(21)53/h1-6,18,23,30,32-33,39,42-46,48-53,59-61H,7H2 |
InChI Key | WTKZYPVTAXZSEM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H28O27 |
Molecular Weight | 952.60 g/mol |
Exact Mass | 952.08179561 g/mol |
Topological Polar Surface Area (TPSA) | 450.00 Ų |
XlogP | -0.60 |
beta-D-Glucopyranose, cyclic 3,6-(4,4',5,5',6,6'-hexahydroxy(1,1'-biphenyl)-2,2'-dicarboxylate) cyclic 2-9:4-1-(3,4,4a,9b-tetrahydro-4,4,4a,6,7-pentahydroxy-3-oxo-1,9-dibenzofurandicarboxylate) 1-(3,4,5-trihydroxybenzoate), stereoisomer |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.47% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 92.60% | 91.49% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 91.82% | 83.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.69% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.48% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.81% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.16% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.99% | 99.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.99% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.80% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.40% | 97.09% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.15% | 95.17% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.04% | 91.19% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.97% | 96.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.16% | 97.33% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 81.67% | 97.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.55% | 92.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.99% | 99.15% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.69% | 91.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.27% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Euphorbia helioscopia |
Euphorbia humifusa |
Euphorbia thymifolia |
Excoecaria kawakamii |
Geranium carolinianum |
Mallotus repandus |
Phyllanthus emblica |
PubChem | 158193 |
LOTUS | LTS0088342 |
wikiData | Q105312628 |