[(1S,4S,5R,6R,7S,8R,11R,13S,16S,17S,18S,19R)-4,5,16,17-tetrahydroxy-6,14,18-trimethyl-9-oxo-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-en-8-yl] (2S)-2-hydroxy-2-methylbutanoate
Internal ID | c54844b0-0587-4ad5-af4d-68a924050643 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | [(1S,4S,5R,6R,7S,8R,11R,13S,16S,17S,18S,19R)-4,5,16,17-tetrahydroxy-6,14,18-trimethyl-9-oxo-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-en-8-yl] (2S)-2-hydroxy-2-methylbutanoate |
SMILES (Canonical) | CCC(C)(C(=O)OC1C2C(C(C3(C4C2(CO3)C(CC5C4(C(C(C=C5C)O)O)C)OC1=O)O)O)C)O |
SMILES (Isomeric) | CC[C@@](C)(C(=O)O[C@@H]1[C@H]2[C@H]([C@H]([C@@]3([C@H]4[C@@]2(CO3)[C@@H](C[C@@H]5[C@@]4([C@@H]([C@H](C=C5C)O)O)C)OC1=O)O)O)C)O |
InChI | InChI=1S/C25H36O10/c1-6-22(4,31)21(30)35-16-15-11(3)17(27)25(32)20-23(5)12(10(2)7-13(26)18(23)28)8-14(34-19(16)29)24(15,20)9-33-25/h7,11-18,20,26-28,31-32H,6,8-9H2,1-5H3/t11-,12+,13+,14-,15-,16-,17-,18-,20-,22+,23-,24+,25-/m1/s1 |
InChI Key | LZKVXMYVBSNXER-AEORHFKVSA-N |
Popularity | 127 references in papers |
Molecular Formula | C25H36O10 |
Molecular Weight | 496.50 g/mol |
Exact Mass | 496.23084734 g/mol |
Topological Polar Surface Area (TPSA) | 163.00 Ų |
XlogP | -0.20 |
CHEMBL3989626 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.13% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.96% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.51% | 86.33% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.14% | 97.79% |
CHEMBL2581 | P07339 | Cathepsin D | 90.84% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.03% | 96.77% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.61% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.12% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.10% | 89.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.78% | 96.47% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 84.13% | 90.93% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.98% | 95.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.84% | 91.07% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.70% | 96.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.64% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.37% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.99% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.42% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.05% | 92.94% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 82.03% | 97.28% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 80.47% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ailanthus excelsus |
Perriera madagascariensis |
Pierreodendron kerstingii |
Simarouba glauca |
Simarouba versicolor |
PubChem | 90469735 |
LOTUS | LTS0151347 |
wikiData | Q104250880 |