3,5,7-trihydroxy-8-[(1R)-1-(4-hydroxy-3-methoxyphenyl)prop-2-enyl]-2-phenylchromen-4-one
Internal ID | 02a7c5a1-f9d6-418b-a6bf-1a67405e0407 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
IUPAC Name | 3,5,7-trihydroxy-8-[(1R)-1-(4-hydroxy-3-methoxyphenyl)prop-2-enyl]-2-phenylchromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C(C=C)C2=C(C=C(C3=C2OC(=C(C3=O)O)C4=CC=CC=C4)O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H](C=C)C2=C(C=C(C3=C2OC(=C(C3=O)O)C4=CC=CC=C4)O)O)O |
InChI | InChI=1S/C25H20O7/c1-3-15(14-9-10-16(26)19(11-14)31-2)20-17(27)12-18(28)21-22(29)23(30)24(32-25(20)21)13-7-5-4-6-8-13/h3-12,15,26-28,30H,1H2,2H3/t15-/m1/s1 |
InChI Key | JRFVOMWWESIGRR-OAHLLOKOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H20O7 |
Molecular Weight | 432.40 g/mol |
Exact Mass | 432.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 5.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.85% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.60% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.27% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.40% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.12% | 89.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.07% | 95.50% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.81% | 99.15% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.18% | 90.20% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.18% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.29% | 94.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.08% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.33% | 94.73% |
CHEMBL2002 | P12268 | Inosine-5'-monophosphate dehydrogenase 2 | 83.66% | 98.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.89% | 96.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 82.72% | 98.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.44% | 90.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.41% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.