3-Phenyl-1-(pyrrolidin-1-yl)prop-2-en-1-one
| Internal ID | 91255086-dd12-4292-85e4-7e2aaa2e4a28 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives |
| IUPAC Name | 3-phenyl-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES (Canonical) | C1CCN(C1)C(=O)C=CC2=CC=CC=C2 |
| SMILES (Isomeric) | C1CCN(C1)C(=O)C=CC2=CC=CC=C2 |
| InChI | InChI=1S/C13H15NO/c15-13(14-10-4-5-11-14)9-8-12-6-2-1-3-7-12/h1-3,6-9H,4-5,10-11H2 |
| InChI Key | JSIGICUAXLIURX-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.115364102 g/mol |
| Topological Polar Surface Area (TPSA) | 20.30 Ų |
| XlogP | 2.40 |
| cinnamic acid pyrrolidid |
| CBDivE_013823 |
| DTXSID10940847 |
| 3-Phenyl-1-(pyrrolidin-1-yl)prop-2-en-1-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.41% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.38% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.82% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.27% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.80% | 96.09% |
| CHEMBL5028 | O14672 | ADAM10 | 86.52% | 97.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.17% | 90.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 82.98% | 83.57% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.46% | 93.99% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.61% | 91.71% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.98% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper argyrophyllum |
| Piper caninum |
| Piper hymenophyllum |
| Piper marginatum |
| Piper methysticum |
| Piper nigrum |
| Piper sarmentosum |
| Piper schmidtii |
| Piper taiwanense |
| PubChem | 583163 |
| LOTUS | LTS0173582 |
| wikiData | Q82917580 |