3'-Methoxyflavone
| Internal ID | 6f575352-d38a-41dd-a18f-898048d0c4d0 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 3-O-methylated flavonoids |
| IUPAC Name | 2-(3-methoxyphenyl)chromen-4-one |
| SMILES (Canonical) | COC1=CC=CC(=C1)C2=CC(=O)C3=CC=CC=C3O2 |
| SMILES (Isomeric) | COC1=CC=CC(=C1)C2=CC(=O)C3=CC=CC=C3O2 |
| InChI | InChI=1S/C16H12O3/c1-18-12-6-4-5-11(9-12)16-10-14(17)13-7-2-3-8-15(13)19-16/h2-10H,1H3 |
| InChI Key | KIEVPIBIYKKJRJ-UHFFFAOYSA-N |
| Popularity | 23 references in papers |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 3.50 |
| 2-(3-methoxyphenyl)chromen-4-one |
| 53906-83-5 |
| 2-(3-Methoxyphenyl)-4H-chromen-4-one |
| 3'-Methoxy-flavone |
| Flavone, 3'-methoxy |
| ST056007 |
| SCHEMBL360247 |
| 3'-methoxyflavone, AldrichCPR |
| CHEMBL342343 |
| CHEBI:63327 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.84% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.45% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.36% | 98.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.84% | 94.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.30% | 92.08% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 92.64% | 93.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.76% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.97% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.37% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.87% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.73% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.95% | 94.73% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.62% | 95.50% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.56% | 92.67% |
| CHEMBL2083 | P15090 | Fatty acid binding protein adipocyte | 85.05% | 95.71% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 84.59% | 94.03% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.28% | 99.15% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.09% | 97.14% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.89% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.04% | 98.75% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.91% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Primula macrophylla |
| Primula veris |
| PubChem | 619834 |
| LOTUS | LTS0180366 |
| wikiData | Q82121051 |