(2R)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one
Internal ID | aeb82b54-870f-4444-89f0-ed84e3b9e57e |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | (2R)-2-(2,4-dihydroxyphenyl)-5,7-dihydroxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)O)C3=C(C=C(C=C3)O)O |
SMILES (Isomeric) | C1[C@@H](OC2=CC(=CC(=C2C1=O)O)O)C3=C(C=C(C=C3)O)O |
InChI | InChI=1S/C15H12O6/c16-7-1-2-9(10(18)3-7)13-6-12(20)15-11(19)4-8(17)5-14(15)21-13/h1-5,13,16-19H,6H2/t13-/m1/s1 |
InChI Key | QBLQLKNOKUHRCH-CYBMUJFWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H12O6 |
Molecular Weight | 288.25 g/mol |
Exact Mass | 288.06338810 g/mol |
Topological Polar Surface Area (TPSA) | 107.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1973 | P14679 | Tyrosinase |
980 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.12% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.93% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.39% | 95.56% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 92.32% | 96.12% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.50% | 93.40% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.37% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.01% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.30% | 96.09% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 87.94% | 95.62% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.36% | 83.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.18% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.89% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.79% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.05% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.75% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.58% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.58% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 80.48% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus lacucha |
Ficus formosana |
Maclura tinctoria |
PubChem | 26213324 |
LOTUS | LTS0160512 |
wikiData | Q105217900 |