6-methyl-3-methylidene-9-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione
Internal ID | 0b2f2bc8-628f-4a47-b899-80834a5ab6cc |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | 6-methyl-3-methylidene-9-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione |
SMILES (Canonical) | CC1=C2C(C3C(CC1)C(=C)C(=O)O3)C(=CC2=O)COC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC1=C2C(C3C(CC1)C(=C)C(=O)O3)C(=CC2=O)COC4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C21H26O9/c1-8-3-4-11-9(2)20(27)30-19(11)15-10(5-12(23)14(8)15)7-28-21-18(26)17(25)16(24)13(6-22)29-21/h5,11,13,15-19,21-22,24-26H,2-4,6-7H2,1H3 |
InChI Key | GHSRDMYBBWWNGL-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H26O9 |
Molecular Weight | 422.40 g/mol |
Exact Mass | 422.15768240 g/mol |
Topological Polar Surface Area (TPSA) | 143.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
![2D Structure of 6-methyl-3-methylidene-9-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione 2D Structure of 6-methyl-3-methylidene-9-[[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-2,7-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2f7ac630-85b5-11ee-85a5-65a58266751b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.63% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.89% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.71% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.03% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.02% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.75% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.29% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.99% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.70% | 97.36% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.24% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.10% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.09% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.98% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.69% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.18% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.45% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.33% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.69% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cichorium endivia |
Crepidiastrum keiskeanum |
Crepidiastrum sonchifolium subsp. sonchifolium |
Crepis multicaulis |
Lactuca triangulata |
Launaea arborescens |
Scorzoneroides atlantica |
Sonchus oleraceus |
PubChem | 13855727 |
LOTUS | LTS0275637 |
wikiData | Q105008708 |