octanoic acid [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-6-acetyloxy-3,3a-dihydroxy-3,6,9-trimethyl-8-(2-methyl-1-oxobut-2-enoxy)-2-oxo-4-(1-oxobutoxy)-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] ester
| Internal ID | 983f1670-d3f1-4d5d-a726-83cd70b1210d |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Pentacarboxylic acids and derivatives |
| IUPAC Name | [(3S,3aR,4S,6S,6aR,7S,8S,9bS)-6-acetyloxy-4-butanoyloxy-3,3a-dihydroxy-3,6,9-trimethyl-8-(2-methylbut-2-enoyloxy)-2-oxo-4,5,6a,7,8,9b-hexahydroazuleno[4,5-b]furan-7-yl] octanoate |
| SMILES (Canonical) | CCCCCCCC(=O)OC1C2C(=C(C1OC(=O)C(=CC)C)C)C3C(C(CC2(C)OC(=O)C)OC(=O)CCC)(C(C(=O)O3)(C)O)O |
| SMILES (Isomeric) | CCCCCCCC(=O)O[C@H]1[C@H]2C(=C([C@@H]1OC(=O)C(=CC)C)C)[C@H]3[C@]([C@H](C[C@]2(C)OC(=O)C)OC(=O)CCC)([C@](C(=O)O3)(C)O)O |
| InChI | InChI=1S/C34H50O12/c1-9-12-13-14-15-17-24(37)43-28-26-25(20(5)27(28)44-30(38)19(4)11-3)29-34(41,33(8,40)31(39)45-29)22(42-23(36)16-10-2)18-32(26,7)46-21(6)35/h11,22,26-29,40-41H,9-10,12-18H2,1-8H3/t22-,26+,27-,28-,29-,32-,33+,34+/m0/s1 |
| InChI Key | IXFPJGBNCFXKPI-LGJGSQFISA-N |
| Popularity | 4,112 references in papers |
| Molecular Formula | C34H50O12 |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.33022703 g/mol |
| Topological Polar Surface Area (TPSA) | 172.00 Ų |
| XlogP | 3.60 |
| Atomic LogP (AlogP) | 3.93 |
| H-Bond Acceptor | 12 |
| H-Bond Donor | 2 |
| Rotatable Bonds | 13 |
| KBioGR_000221 |
| KBioSS_000221 |
| KBio2_000221 |
| KBio2_002789 |
| KBio2_005357 |
| KBio3_000441 |
| KBio3_000442 |
| Bio1_000202 |
| Bio1_000691 |
| Bio1_001180 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9737 | 97.37% |
| Caco-2 | - | 0.7915 | 79.15% |
| Blood Brain Barrier | + | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Mitochondria | 0.7331 | 73.31% |
| OATP2B1 inhibitior | - | 0.8608 | 86.08% |
| OATP1B1 inhibitior | + | 0.8356 | 83.56% |
| OATP1B3 inhibitior | + | 0.8700 | 87.00% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.6500 | 65.00% |
| BSEP inhibitior | + | 0.9812 | 98.12% |
| P-glycoprotein inhibitior | + | 0.8311 | 83.11% |
| P-glycoprotein substrate | + | 0.9296 | 92.96% |
| CYP3A4 substrate | + | 0.7008 | 70.08% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.9059 | 90.59% |
| CYP3A4 inhibition | + | 0.7960 | 79.60% |
| CYP2C9 inhibition | + | 0.8537 | 85.37% |
| CYP2C19 inhibition | + | 0.8601 | 86.01% |
| CYP2D6 inhibition | - | 0.9228 | 92.28% |
| CYP1A2 inhibition | + | 0.9106 | 91.06% |
| CYP2C8 inhibition | + | 0.6185 | 61.85% |
| CYP inhibitory promiscuity | - | 0.8693 | 86.93% |
| UGT catelyzed | - | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.5505 | 55.05% |
| Eye corrosion | - | 0.9871 | 98.71% |
| Eye irritation | - | 0.9116 | 91.16% |
| Skin irritation | + | 0.5425 | 54.25% |
| Skin corrosion | - | 0.9194 | 91.94% |
| Ames mutagenesis | - | 0.7700 | 77.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5584 | 55.84% |
| Micronuclear | - | 0.7800 | 78.00% |
| Hepatotoxicity | - | 0.5500 | 55.00% |
| skin sensitisation | - | 0.8656 | 86.56% |
| Respiratory toxicity | + | 0.5222 | 52.22% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.5494 | 54.94% |
| Acute Oral Toxicity (c) | II | 0.4100 | 41.00% |
| Estrogen receptor binding | + | 0.7807 | 78.07% |
| Androgen receptor binding | + | 0.7088 | 70.88% |
| Thyroid receptor binding | + | 0.5182 | 51.82% |
| Glucocorticoid receptor binding | + | 0.7977 | 79.77% |
| Aromatase binding | + | 0.7557 | 75.57% |
| PPAR gamma | + | 0.6723 | 67.23% |
| Honey bee toxicity | - | 0.7698 | 76.98% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.7375 | 73.75% |
| Fish aquatic toxicity | + | 0.9925 | 99.25% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293298 | Q01453 | Peripheral myelin protein 22 |
60.1 nM |
Potency |
via Super-PRED
|
| CHEMBL3901 | P16615 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 |
210 nM |
IC50 |
via Super-PRED
|
| CHEMBL2401 | Q93084 | Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 |
210 nM |
IC50 |
via Super-PRED
|
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
3.7 nM |
Potency |
via Super-PRED
|
| CHEMBL1293256 | P40225 | Thrombopoietin |
50.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.38% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.94% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.91% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.62% | 89.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 93.51% | 97.79% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 92.44% | 98.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.22% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 90.67% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.86% | 99.23% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.28% | 95.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.63% | 92.62% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.16% | 89.63% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.92% | 93.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 86.77% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.41% | 86.33% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.79% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.14% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.29% | 97.25% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.02% | 94.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.09% | 95.89% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.06% | 92.86% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.83% | 93.56% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.74% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.88% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.64% | 91.19% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.59% | 94.75% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 80.20% | 85.94% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 80.17% | 82.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Thapsia garganica |
| Thapsia villosa |
| PubChem | 49926 |
| LOTUS | LTS0031767 |
| wikiData | Q27164929 |