(2e,4e,8z)-2'-hydroxy-N-isobutyl-2,4,8-tetradecatrienamide
| Internal ID | 7762e5af-284c-450a-8b39-2f1f5a214985 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty amides > N-acyl amines |
| IUPAC Name | (2E,4E,8Z)-N-(2-hydroxy-2-methylpropyl)tetradeca-2,4,8-trienamide |
| SMILES (Canonical) | CCCCCC=CCCC=CC=CC(=O)NCC(C)(C)O |
| SMILES (Isomeric) | CCCCC/C=C\CC/C=C/C=C/C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C18H31NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(20)19-16-18(2,3)21/h8-9,12-15,21H,4-7,10-11,16H2,1-3H3,(H,19,20)/b9-8-,13-12+,15-14+ |
| InChI Key | OMYRBCZBTQDJHF-RFYAXJIXSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.235479232 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 4.20 |
| (2e,4e,8z)-2'-hydroxy-N-isobutyl-2,4,8-tetradecatrienamide |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.87% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.45% | 99.17% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 94.40% | 89.34% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.22% | 89.63% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.54% | 96.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 92.15% | 97.29% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.39% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.46% | 97.25% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.95% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.07% | 93.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.52% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.40% | 94.73% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.10% | 92.08% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.54% | 97.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.57% | 94.33% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.75% | 96.90% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 81.52% | 96.00% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 80.53% | 86.67% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.45% | 95.71% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.43% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.17% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum bungeanum |
| Zanthoxylum schinifolium |
| PubChem | 5316694 |
| LOTUS | LTS0092744 |
| wikiData | Q105194548 |