5',7,9,13-Tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol
Internal ID | 111f0903-1814-40b9-81ce-d4217fe9aed5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6(C5(CC(C(C6)O)O)C)O)O)C)C)OC1 |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6(C5(CC(C(C6)O)O)C)O)O)C)C)OC1 |
InChI | InChI=1S/C27H44O6/c1-14-5-8-27(32-13-14)15(2)23-21(33-27)10-18-16-9-22(30)26(31)12-20(29)19(28)11-25(26,4)17(16)6-7-24(18,23)3/h14-23,28-31H,5-13H2,1-4H3 |
InChI Key | JASYOPOIUHUBJK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H44O6 |
Molecular Weight | 464.60 g/mol |
Exact Mass | 464.31378912 g/mol |
Topological Polar Surface Area (TPSA) | 99.40 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.61% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.50% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.36% | 97.25% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 93.18% | 89.05% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 93.17% | 96.61% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.39% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.57% | 85.14% |
CHEMBL204 | P00734 | Thrombin | 91.52% | 96.01% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 90.22% | 95.58% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.16% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.94% | 82.69% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 88.93% | 97.31% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.56% | 95.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.32% | 95.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.11% | 92.94% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.77% | 92.86% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.05% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.28% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.08% | 95.93% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 84.03% | 95.38% |
CHEMBL1871 | P10275 | Androgen Receptor | 83.73% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.54% | 89.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 82.45% | 97.64% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 82.38% | 87.16% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 82.30% | 97.86% |
CHEMBL237 | P41145 | Kappa opioid receptor | 81.64% | 98.10% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 81.55% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.69% | 95.89% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 80.60% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium karataviense |
Allium minutiflorum |
Allium stipitatum |
PubChem | 3761894 |
LOTUS | LTS0100022 |
wikiData | Q105124002 |