28-Nor-20(29)-lupene-diol
Internal ID | 02c12008-9ea6-487e-af7a-7807cce5c09f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a,9-diol |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)O)C)O |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)O |
InChI | InChI=1S/C29H48O2/c1-18(2)19-10-15-29(31)17-16-27(6)20(24(19)29)8-9-22-26(5)13-12-23(30)25(3,4)21(26)11-14-28(22,27)7/h19-24,30-31H,1,8-17H2,2-7H3/t19-,20+,21-,22+,23-,24+,26-,27+,28+,29-/m0/s1 |
InChI Key | QMYGTTSPVRKRJP-SKEMKGFNSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H48O2 |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 7.70 |
28-Nor-20(29)-lupene-diol |
202651-66-9 |
28-Norlup-20(29)-ene-3beta,17beta-diol |
![2D Structure of 28-Nor-20(29)-lupene-diol 2D Structure of 28-Nor-20(29)-lupene-diol](https://plantaedb.com/storage/docs/compounds/2023/07/28-nor-2029-lupene-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.52% | 92.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.88% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 89.51% | 98.95% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.45% | 82.69% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.42% | 96.61% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.10% | 90.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.12% | 94.75% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.27% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.22% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.16% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.86% | 95.89% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 82.38% | 97.64% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.20% | 97.09% |
CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 82.14% | 95.42% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.04% | 92.97% |
CHEMBL233 | P35372 | Mu opioid receptor | 80.71% | 97.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.54% | 92.86% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.51% | 95.38% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 80.32% | 98.99% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.21% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 15838686 |
NPASS | NPC42853 |
ChEMBL | CHEMBL488988 |
LOTUS | LTS0130253 |
wikiData | Q105224249 |