2,6-Dimethoxy-3-methyl-9H-carbazole
| Internal ID | abfb9beb-6baf-4aab-9640-59ea997190e8 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 2,6-dimethoxy-3-methyl-9H-carbazole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO2/c1-9-6-11-12-7-10(17-2)4-5-13(12)16-14(11)8-15(9)18-3/h4-8,16H,1-3H3 |
| InChI Key | MKQKWPIESXSKSS-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 34.30 Ų |
| XlogP | 3.70 |
| Glycozolidine |
| 9H-Carbazole, 2,6-dimethoxy-3-methyl- |
| 29093-41-2 |
| CHEMBL463555 |
| SCHEMBL15203441 |
| SCHEMBL30071363 |
| 2,6-dimethoxy-3-methylcarbazole |
| DTXSID70183339 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.49% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.29% | 95.56% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 92.97% | 93.31% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.48% | 93.99% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.31% | 98.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.12% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.95% | 94.45% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 89.76% | 95.70% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.52% | 97.36% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.98% | 90.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.58% | 92.94% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.16% | 96.09% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 87.14% | 85.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.17% | 96.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 82.56% | 93.24% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.18% | 93.18% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 81.28% | 96.47% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.24% | 89.62% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.12% | 100.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.09% | 91.71% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 80.58% | 89.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis mauritiana |
| Glycosmis pentaphylla |
| PubChem | 147297 |
| LOTUS | LTS0097554 |
| wikiData | Q83054097 |