24alpha-Ethyl-5alpha-cholest-7-en-3beta-ol
Internal ID | 441044cb-9c63-4726-81b4-aaa0245339d3 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (3S,5S,9R,10S,13R,14R,17R)-17-[(2R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CCC(CCC(C)C1CCC2C1(CCC3C2=CCC4C3(CCC(C4)O)C)C)C(C)C |
SMILES (Isomeric) | CCC(CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |
InChI | InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h11,19-23,25-27,30H,7-10,12-18H2,1-6H3/t20-,21?,22+,23+,25-,26+,27+,28+,29-/m1/s1 |
InChI Key | YSKVBPGQYRAUQO-WJZNMZDTSA-N |
Popularity | 8 references in papers |
Molecular Formula | C29H50O |
Molecular Weight | 414.70 g/mol |
Exact Mass | 414.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.36% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.40% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.76% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.73% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.33% | 91.11% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.76% | 82.69% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.52% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.15% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.02% | 93.56% |
CHEMBL240 | Q12809 | HERG | 86.08% | 89.76% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.98% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.35% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.29% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 85.11% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.22% | 92.88% |
CHEMBL1977 | P11473 | Vitamin D receptor | 82.74% | 99.43% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.68% | 100.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.54% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.04% | 92.62% |
CHEMBL268 | P43235 | Cathepsin K | 80.19% | 96.85% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kalanchoe marmorata |
Setaria italica |
PubChem | 12315370 |
LOTUS | LTS0031226 |
wikiData | Q104375810 |