2,4,6,3',5'-Pentahydroxybenzophenone
Internal ID | ea412f4d-b5ea-4600-b7f0-24b7c7ee9e38 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
IUPAC Name | (3,5-dihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |
SMILES (Canonical) | C1=C(C=C(C=C1O)O)C(=O)C2=C(C=C(C=C2O)O)O |
SMILES (Isomeric) | C1=C(C=C(C=C1O)O)C(=O)C2=C(C=C(C=C2O)O)O |
InChI | InChI=1S/C13H10O6/c14-7-1-6(2-8(15)3-7)13(19)12-10(17)4-9(16)5-11(12)18/h1-5,14-18H |
InChI Key | UQRUMZDBXRBEPM-UHFFFAOYSA-N |
Popularity | 6 references in papers |
Molecular Formula | C13H10O6 |
Molecular Weight | 262.21 g/mol |
Exact Mass | 262.04773803 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 2.00 |
SCHEMBL9639010 |
BDBM50327909 |
2,3',4,5',6-Pentahydroxybenzophenone |
2,4,6,3',5'-Pentahydroxybenzophenone |
2,4,6,3'',5''-pentahydroxybenzophenone |
J3.538.410C |
(3,5-dihydroxyphenyl)(2,4,6-trihydroxyphenyl)methanone |
(3,5-dihydroxyphenyl)-(2,4,6-trihydroxyphenyl)methanone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4158 | P49327 | Fatty acid synthase |
8590 nM |
IC50 |
PMID: 20817450
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.43% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 91.59% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.35% | 90.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 83.62% | 96.12% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.77% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.21% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.03% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 19910294 |
NPASS | NPC10926 |
ChEMBL | CHEMBL1256380 |
LOTUS | LTS0002649 |
wikiData | Q105277420 |