2,4,2',4'-Tetrahydroxychalcone
Internal ID | 86f78352-6b81-47db-ab3c-efcd472a56f4 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (E)-1,3-bis(2,4-dihydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=C(C=C1O)O)C=CC(=O)C2=C(C=C(C=C2)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1O)O)/C=C/C(=O)C2=C(C=C(C=C2)O)O |
InChI | InChI=1S/C15H12O5/c16-10-3-1-9(14(19)7-10)2-6-13(18)12-5-4-11(17)8-15(12)20/h1-8,16-17,19-20H/b6-2+ |
InChI Key | ZWTDXYUDJYDHJR-QHHAFSJGSA-N |
Popularity | 10 references in papers |
Molecular Formula | C15H12O5 |
Molecular Weight | 272.25 g/mol |
Exact Mass | 272.06847348 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 2.80 |
2,2',4,4'-tetrahydroxychalcone |
CHEMBL394855 |
D0BH2T |
SCHEMBL675094 |
2,2'',4,4''-tetrahydroxychalcone |
2,4,2'',4''-tetrahydroxychalcone |
BDBM50203985 |
LMPK12120128 |
2,2',4,4'-Tetrahydroxy-trans-chalcone |
PD148015 |
![2D Structure of 2,4,2',4'-Tetrahydroxychalcone 2D Structure of 2,4,2',4'-Tetrahydroxychalcone](https://plantaedb.com/storage/docs/compounds/2023/07/2424-tetrahydroxychalcone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1973 | P14679 | Tyrosinase |
70 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 95.57% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.59% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.17% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.32% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.79% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.78% | 89.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.11% | 93.40% |
CHEMBL2535 | P11166 | Glucose transporter | 81.43% | 98.75% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.26% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.02% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Broussonetia papyrifera |
Morus mongolica |
Morus nigra |
PubChem | 10107266 |
NPASS | NPC267552 |
ChEMBL | CHEMBL394855 |
LOTUS | LTS0175467 |
wikiData | Q76415138 |