2,4-Tetradecadienoic acid isobutyl amide
Internal ID | ae89633b-10bf-4509-8bdc-a8e2e0d24c07 |
Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
IUPAC Name | N-(2-methylpropyl)tetradeca-2,4-dienamide |
SMILES (Canonical) | CCCCCCCCCC=CC=CC(=O)NCC(C)C |
SMILES (Isomeric) | CCCCCCCCCC=CC=CC(=O)NCC(C)C |
InChI | InChI=1S/C18H33NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-18(20)19-16-17(2)3/h12-15,17H,4-11,16H2,1-3H3,(H,19,20) |
InChI Key | AGJAUFUNZWHLKE-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C18H33NO |
Molecular Weight | 279.50 g/mol |
Exact Mass | 279.256214676 g/mol |
Topological Polar Surface Area (TPSA) | 29.10 Ų |
XlogP | 6.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor |
52 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.88% | 97.29% |
CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.10% | 99.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.55% | 89.63% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.31% | 96.09% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 92.75% | 92.86% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.58% | 89.34% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.23% | 93.56% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 89.17% | 87.45% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.75% | 95.71% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 88.58% | 85.94% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.52% | 90.17% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.63% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.31% | 96.47% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.90% | 94.45% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.70% | 96.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.02% | 94.73% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.58% | 94.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.89% | 91.11% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.89% | 100.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.17% | 92.08% |
CHEMBL299 | P17252 | Protein kinase C alpha | 82.46% | 98.03% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.70% | 96.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.33% | 90.71% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.27% | 97.21% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 80.09% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Argyranthemum frutescens |
Cirsium canum |
Piper nigrum |
Piper sarmentosum |
Zanthoxylum ailanthoides |
Zanthoxylum integrifoliolum |
Zanthoxylum petiolare |
PubChem | 85248609 |
LOTUS | LTS0234972 |
wikiData | Q103816095 |