2,3,5-Tribromo-6-(3,5-dibromo-2-hydroxyphenoxy)phenol
Internal ID | d5905fc2-9bc2-442c-81c2-457716126b12 |
Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylethers > Bromodiphenyl ethers |
IUPAC Name | 2,3,5-tribromo-6-(3,5-dibromo-2-hydroxyphenoxy)phenol |
SMILES (Canonical) | C1=C(C=C(C(=C1OC2=C(C(=C(C=C2Br)Br)Br)O)O)Br)Br |
SMILES (Isomeric) | C1=C(C=C(C(=C1OC2=C(C(=C(C=C2Br)Br)Br)O)O)Br)Br |
InChI | InChI=1S/C12H5Br5O3/c13-4-1-6(15)10(18)8(2-4)20-12-7(16)3-5(14)9(17)11(12)19/h1-3,18-19H |
InChI Key | OBMWDTFRQJRRIM-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C12H5Br5O3 |
Molecular Weight | 596.70 g/mol |
Exact Mass | 595.61146 g/mol |
Topological Polar Surface Area (TPSA) | 49.70 Ų |
XlogP | 6.20 |
CHEMBL148503 |
80246-26-0 |
SCHEMBL14385345 |
DTXSID40438429 |
BDBM50150788 |
2,3',4,5,5'-Pentabromo-2',6-dihydroxydiphenyl ether |
2,3,5-Tribromo-6-(3,5-dibromo-2-hydroxy-phenoxy)-phenol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3687 | P18054 | Arachidonate 12-lipoxygenase |
6200 nM |
IC50 |
PMID: 15267244
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
2500 nM 2200 nM |
IC50 IC50 |
PMID: 7494145
PMID: 15267244 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.81% | 91.11% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 94.05% | 83.57% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.44% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.14% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.78% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 83.31% | 89.62% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 82.68% | 80.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.86% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.49% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.56% | 86.33% |
CHEMBL5905 | Q04828 | Aldo-keto reductase family 1 member C1 | 80.38% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 10348509 |
NPASS | NPC40302 |
ChEMBL | CHEMBL148503 |
LOTUS | LTS0056459 |
wikiData | Q82254172 |