2,3,14,22,25-Pentahydroxycholest-7-en-6-one
Internal ID | a6ef0c50-d661-4793-aee5-ca5f57336d18 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Hydroxy bile acids, alcohols and derivatives > Pentahydroxy bile acids, alcohols and derivatives |
IUPAC Name | 17-(3,6-dihydroxy-6-methylheptan-2-yl)-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
SMILES (Canonical) | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)O)O |
SMILES (Isomeric) | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)O)O |
InChI | InChI=1S/C27H44O6/c1-15(20(28)8-9-24(2,3)32)16-7-11-27(33)18-12-21(29)19-13-22(30)23(31)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19-20,22-23,28,30-33H,6-11,13-14H2,1-5H3 |
InChI Key | UPEZCKBFRMILAV-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C27H44O6 |
Molecular Weight | 464.60 g/mol |
Exact Mass | 464.31378912 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | 1.70 |
FT-0603641 |
FT-0699558 |
2,3,14,22,25-pentahydroxycholest-7-en-6-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.84% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.45% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.59% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.72% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.04% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.21% | 82.69% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 92.89% | 94.78% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 91.53% | 96.61% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.13% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.66% | 89.34% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.42% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.78% | 95.89% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.60% | 90.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.73% | 97.79% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.39% | 95.56% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.34% | 95.93% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.30% | 97.14% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 85.11% | 98.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.80% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.37% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.61% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.26% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.92% | 86.33% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.32% | 97.05% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.83% | 85.31% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.58% | 91.07% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 4233007 |
LOTUS | LTS0050438 |
wikiData | Q105276757 |