[(1S,2S,4S,5S,6R)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 4-hydroxybenzoate
Internal ID | da862ec3-a4b2-47b7-926d-27e0351d8cd8 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | [(1S,2S,4S,5S,6R)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 4-hydroxybenzoate |
SMILES (Canonical) | C1=COC(C2C1C(C3C2(O3)CO)OC(=O)C4=CC=C(C=C4)O)OC5C(C(C(C(O5)CO)O)O)O |
SMILES (Isomeric) | C1=COC([C@H]2[C@@H]1[C@@H]([C@H]3[C@@]2(O3)CO)OC(=O)C4=CC=C(C=C4)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChI | InChI=1S/C22H26O12/c23-7-12-14(26)15(27)16(28)21(31-12)33-20-13-11(5-6-30-20)17(18-22(13,8-24)34-18)32-19(29)9-1-3-10(25)4-2-9/h1-6,11-18,20-21,23-28H,7-8H2/t11-,12-,13-,14-,15+,16-,17+,18+,20?,21+,22-/m1/s1 |
InChI Key | UXSACQOOWZMGSE-HWUWICDZSA-N |
Popularity | 11 references in papers |
Molecular Formula | C22H26O12 |
Molecular Weight | 482.40 g/mol |
Exact Mass | 482.14242626 g/mol |
Topological Polar Surface Area (TPSA) | 188.00 Ų |
XlogP | -1.30 |
C22H26O12 |
C22-H26-O12 |
6736-85-2 |
C09775 |
CHEBI:3465 |
.beta.-D-Glucopyranoside, 1a,1b,2,5a,6,6a-hexahydro-6-[(4-hydroxybenzoyl)oxy]-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-2-yl, [1aS-(1a.alpha.,1b.beta.,2.beta.,5a.beta.,6.beta.,6a.alpha.)]- |
Q27106093 |
![2D Structure of [(1S,2S,4S,5S,6R)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 4-hydroxybenzoate 2D Structure of [(1S,2S,4S,5S,6R)-2-(hydroxymethyl)-10-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl] 4-hydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/07/22e997b0-249f-11ee-bae6-7565d1c6e9e8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha |
12 nM |
Kd |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.26% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.54% | 91.49% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 91.36% | 94.97% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.28% | 86.33% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 88.30% | 94.23% |
CHEMBL2581 | P07339 | Cathepsin D | 88.22% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.98% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.96% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.61% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.43% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.22% | 89.67% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.59% | 89.00% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.17% | 83.57% |
CHEMBL3232685 | O00257 | E3 SUMO-protein ligase CBX4 | 84.00% | 93.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.86% | 95.83% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.17% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 82.92% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.38% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.33% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adonis sutchuenensis |
Buddleja officinalis |
Catalpa bignonioides |
Catalpa ovata |
Neopicrorhiza scrophulariiflora |
Paulownia tomentosa |
Rehmannia glutinosa |
Veronica persica |