(1R,3S,4R)-4-ethenyl-1-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-8-one
Internal ID | 9ee87dd5-cf6d-4f1c-9c92-d8985c3796cb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (1R,3S,4R)-4-ethenyl-1-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-8-one |
SMILES (Canonical) | COC1C2=C(CCOC2=O)C(C(O1)OC3C(C(C(C(O3)CO)O)O)O)C=C |
SMILES (Isomeric) | CO[C@H]1C2=C(CCOC2=O)[C@H]([C@@H](O1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C=C |
InChI | InChI=1S/C17H24O10/c1-3-7-8-4-5-24-14(22)10(8)16(23-2)26-15(7)27-17-13(21)12(20)11(19)9(6-18)25-17/h3,7,9,11-13,15-21H,1,4-6H2,2H3/t7-,9-,11-,12+,13-,15+,16-,17+/m1/s1 |
InChI Key | MUKQLKZEUVJQEM-WCCBYWBDSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H24O10 |
Molecular Weight | 388.40 g/mol |
Exact Mass | 388.13694696 g/mol |
Topological Polar Surface Area (TPSA) | 144.00 Ų |
XlogP | -1.60 |
There are no found synonyms. |
![2D Structure of (1R,3S,4R)-4-ethenyl-1-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-8-one 2D Structure of (1R,3S,4R)-4-ethenyl-1-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4,5,6-tetrahydro-1H-pyrano[3,4-c]pyran-8-one](https://plantaedb.com/storage/docs/compounds/2023/11/22d23910-85b9-11ee-bee0-4de819391fe5.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.16% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 94.93% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.49% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.54% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.45% | 86.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.83% | 91.24% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.49% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.13% | 99.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.35% | 95.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.15% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.15% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.85% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.37% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.24% | 97.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.96% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.88% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.99% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gentiana scabra |
Swertia japonica |
PubChem | 11361225 |
LOTUS | LTS0203580 |
wikiData | Q105172496 |