2(1H)-Quinolinone, 4,7,8-trimethoxy-1-methyl-3-(3-methyl-2-butenyl)-
| Internal ID | a5e02c20-4ed6-4b54-859b-1a464413e7b5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 4,7,8-trimethoxy-1-methyl-3-(3-methylbut-2-enyl)quinolin-2-one |
| SMILES (Canonical) | CC(=CCC1=C(C2=C(C(=C(C=C2)OC)OC)N(C1=O)C)OC)C |
| SMILES (Isomeric) | CC(=CCC1=C(C2=C(C(=C(C=C2)OC)OC)N(C1=O)C)OC)C |
| InChI | InChI=1S/C18H23NO4/c1-11(2)7-8-13-16(22-5)12-9-10-14(21-4)17(23-6)15(12)19(3)18(13)20/h7,9-10H,8H2,1-6H3 |
| InChI Key | RKOPYQDWUOSPQI-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 48.00 Ų |
| XlogP | 3.10 |
| 2(1H)-Quinolinone, 4,7,8-trimethoxy-1-methyl-3-(3-methyl-2-butenyl)- |
| DTXSID50438011 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.22% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.97% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.53% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.00% | 85.14% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.38% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.79% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.79% | 94.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.40% | 98.59% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.05% | 89.62% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.08% | 90.20% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 82.93% | 92.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.20% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dictamnus albus |
| Vepris louisii |
| PubChem | 10313744 |
| LOTUS | LTS0273513 |
| wikiData | Q82253616 |