methyl (E)-2-[(2S,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate
Internal ID | b14141b7-a599-47ec-b498-4e89e3d8607b |
Taxonomy | Alkaloids and derivatives > Corynanthean-type alkaloids |
IUPAC Name | methyl (E)-2-[(2S,12bS)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate |
SMILES (Canonical) | CCC1CN2CCC3=C(C2CC1C(=COC)C(=O)OC)NC4=CC=CC=C34 |
SMILES (Isomeric) | CCC1CN2CCC3=C([C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)NC4=CC=CC=C34 |
InChI | InChI=1S/C22H28N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h5-8,13-14,17,20,23H,4,9-12H2,1-3H3/b18-13+/t14?,17-,20-/m0/s1 |
InChI Key | NMLUOJBSAYAYEM-VXQWDRHASA-N |
Popularity | 35 references in papers |
Molecular Formula | C22H28N2O3 |
Molecular Weight | 368.50 g/mol |
Exact Mass | 368.20999276 g/mol |
Topological Polar Surface Area (TPSA) | 54.60 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL223 | P25100 | Alpha-1d adrenergic receptor |
41.7 nM |
Ki |
via Super-PRED
|
CHEMBL233 | P35372 | Mu opioid receptor |
118 nM |
Ki |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.14% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.96% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.17% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.77% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.46% | 98.95% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 90.34% | 98.59% |
CHEMBL2535 | P11166 | Glucose transporter | 90.01% | 98.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.95% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.64% | 99.17% |
CHEMBL5028 | O14672 | ADAM10 | 85.43% | 97.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.25% | 99.23% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.12% | 97.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.45% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cephalanthus occidentalis |
Corynanthe pachyceras |
Uncaria callophylla |
Uncaria rhynchophylla |
Uncaria sinensis |
Uncaria tomentosa |
PubChem | 101287817 |
LOTUS | LTS0108618 |
wikiData | Q104253202 |