4-Hydroxy-3,5-dimethoxyphenyl beta-D-glucopyranoside; (-)-3,5-Dimethoxy-4-hydroxyphenyl beta-D-glucopyranoside
| Internal ID | be14500d-8514-4f69-81ca-5155f6c68349 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)OC2C(C(C(C(O2)CO)O)O)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)OC2C(C(C(C(O2)CO)O)O)O |
| InChI | InChI=1S/C14H20O9/c1-20-7-3-6(4-8(21-2)10(7)16)22-14-13(19)12(18)11(17)9(5-15)23-14/h3-4,9,11-19H,5H2,1-2H3 |
| InChI Key | SWHCKWOYUSDWOF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.11073221 g/mol |
| Topological Polar Surface Area (TPSA) | 138.00 Ų |
| XlogP | -0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.03% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.07% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.95% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.54% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.62% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.93% | 94.73% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.26% | 97.36% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.03% | 92.94% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.61% | 92.62% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.88% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.44% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.39% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Acer saccharum |
| Canthium berberidifolium |
| Capparis flavicans |
| Castanopsis fissa |
| Embelia ribes |
| Eurycorymbus cavaleriei |
| Iodes cirrhosa |
| Laguncularia racemosa |
| PubChem | 73981643 |
| LOTUS | LTS0215775 |
| wikiData | Q105262674 |