2-Methoxybenzoic acid
| Internal ID | 8f3dfbd7-5fc6-4eae-9b09-477579da1bc9 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Methoxybenzoic acids and derivatives > O-methoxybenzoic acids and derivatives |
| IUPAC Name | 2-methoxybenzoic acid |
| SMILES (Canonical) | COC1=CC=CC=C1C(=O)O |
| SMILES (Isomeric) | COC1=CC=CC=C1C(=O)O |
| InChI | InChI=1S/C8H8O3/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChI Key | ILUJQPXNXACGAN-UHFFFAOYSA-N |
| Popularity | 511 references in papers |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.047344113 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.60 |
| o-Anisic acid |
| 579-75-9 |
| O-Methylsalicylic acid |
| o-Methoxybenzoic acid |
| 2-Anisic acid |
| Benzoic acid, 2-methoxy- |
| Salicylic acid methyl ether |
| 529-75-9 |
| 2-Methoxy-benzoic acid |
| 2-Methoxybenzoicacid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.98% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.76% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 92.19% | 95.50% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.68% | 86.33% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.26% | 90.20% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.89% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.28% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.04% | 93.00% |
| CHEMBL2321614 | Q9NPC2 | Potassium channel subfamily K member 9 | 82.61% | 80.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.08% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Betula pendula |
| Brickellia veronicaefolia |
| Brickellia veronicifolia |
| Capsicum annuum |
| Desmos chinensis |
| Isatis tinctoria |
| Lonicera japonica |
| Nepeta racemosa |
| Origanum minutiflorum |
| Paeonia suffruticosa |
| PubChem | 11370 |
| LOTUS | LTS0185551 |
| wikiData | Q2018545 |