2-Isopropenyl-2,3-dihydronaphtho[2,3-b]furan-4,9-dione
| Internal ID | ff2bbb9a-eac6-4a9d-8d87-fe5e54ba99a9 |
| Taxonomy | Organoheterocyclic compounds > Naphthofurans |
| IUPAC Name | 2-prop-1-en-2-yl-2,3-dihydrobenzo[f][1]benzofuran-4,9-dione |
| SMILES (Canonical) | CC(=C)C1CC2=C(O1)C(=O)C3=CC=CC=C3C2=O |
| SMILES (Isomeric) | CC(=C)C1CC2=C(O1)C(=O)C3=CC=CC=C3C2=O |
| InChI | InChI=1S/C15H12O3/c1-8(2)12-7-11-13(16)9-5-3-4-6-10(9)14(17)15(11)18-12/h3-6,12H,1,7H2,2H3 |
| InChI Key | ZDMOREUAQLXRCQ-UHFFFAOYSA-N |
| Popularity | 8 references in papers |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.078644241 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 3.00 |
| NSC629754 |
| 51920-95-7 |
| 2-Isopropenyl-2,3-dihydronaphtho[2,3-b]furan-4,9-dione |
| Dehydro iso-.alpha.-lapachone |
| CHEMBL221630 |
| DTXSID10966244 |
| NSC-629754 |
| NCI60_009666 |
| 2-isopropenyl-2,3-dihydrobenzo[f]benzofuran-4,9-dione |
| 2,3-dihydro-2-(1-methyl-ethenyl)naphtho[2,3-b ]furan-4,9-dione |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 2-Isopropenyl-2,3-dihydronaphtho[2,3-b]furan-4,9-dione](https://plantaedb.com/storage/docs/compounds/2023/11/2-isopropenyl-23-dihydronaphtho23-bfuran-49-dione.jpg "2D Structure of 2-Isopropenyl-2,3-dihydronaphtho[2,3-b]furan-4,9-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.79% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.17% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.86% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.59% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.38% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.26% | 89.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.04% | 91.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.43% | 93.65% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.99% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.51% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ekmanianthe longiflora |
| Lantana involucrata |
| Newbouldia laevis |
| Oroxylum indicum |
| Radermachera sinica |
| PubChem | 364109 |
| LOTUS | LTS0149786 |
| wikiData | Q82948633 |