[2-Hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] octadeca-9,12,15-trienoate
Internal ID | b9a6cda3-0901-407c-92d4-b2a3ac1916fb |
Taxonomy | Lipids and lipid-like molecules > Glycerolipids > Glycosylglycerols > Glycosylmonoacylglycerols |
IUPAC Name | [2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] octadeca-9,12,15-trienoate |
SMILES (Canonical) | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)O |
SMILES (Isomeric) | CCC=CCC=CCC=CCCCCCCCC(=O)OCC(COC1C(C(C(C(O1)CO)O)O)O)O |
InChI | InChI=1S/C27H46O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(30)34-19-21(29)20-35-27-26(33)25(32)24(31)22(18-28)36-27/h3-4,6-7,9-10,21-22,24-29,31-33H,2,5,8,11-20H2,1H3 |
InChI Key | HUSISCNTLUEZCN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H46O9 |
Molecular Weight | 514.60 g/mol |
Exact Mass | 514.31418304 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.60% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.93% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.73% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.56% | 92.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.32% | 96.00% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.23% | 97.29% |
CHEMBL220 | P22303 | Acetylcholinesterase | 86.68% | 94.45% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 86.03% | 85.94% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.18% | 94.33% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.35% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.18% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.68% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.47% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Clinacanthus nutans |
Guapira graciliflora |
Isatis tinctoria |
Sonchus arvensis |
PubChem | 72984398 |
LOTUS | LTS0272958 |
wikiData | Q105034012 |