2-(7-Methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal
Internal ID | 4e31cf47-6624-40d3-ae98-344f67697558 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 2-(7-methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal |
SMILES (Canonical) | CC(=C(C=O)C1=C(C=CC2=C1OC(=O)C=C2)OC)C |
SMILES (Isomeric) | CC(=C(C=O)C1=C(C=CC2=C1OC(=O)C=C2)OC)C |
InChI | InChI=1S/C15H14O4/c1-9(2)11(8-16)14-12(18-3)6-4-10-5-7-13(17)19-15(10)14/h4-8H,1-3H3 |
InChI Key | PBAZKMWQUBDDLZ-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C15H14O4 |
Molecular Weight | 258.27 g/mol |
Exact Mass | 258.08920892 g/mol |
Topological Polar Surface Area (TPSA) | 52.60 Ų |
XlogP | 2.80 |
53011-72-6 |
2-(7-Methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal |
CHEMBL1098016 |
2-(7-Methoxy-2-oxo-2H-chromen-8-yl)-3-methylbut-2-enal |
7-Methoxy-alpha-(1-methylethylidene)-2-oxo-2H-1-benzopyran-8-acetaldehyde |
DTXSID40201059 |
BDBM50428427 |
AKOS032948558 |
Murralongin, >=95% (LC/MS-ELSD) |
XM163795 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of 2-(7-Methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal 2D Structure of 2-(7-Methoxy-2-oxochromen-8-yl)-3-methylbut-2-enal](https://plantaedb.com/storage/docs/compounds/2023/07/2-7-methoxy-2-oxochromen-8-yl-3-methylbut-2-enal.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL261 | P00915 | Carbonic anhydrase I |
9110 nM |
Ki |
PMID: 22892213
|
CHEMBL3594 | Q16790 | Carbonic anhydrase IX |
8120 nM |
Ki |
PMID: 22892213
|
CHEMBL2326 | P43166 | Carbonic anhydrase VII |
8850 nM |
Ki |
PMID: 22892213
|
CHEMBL3242 | O43570 | Carbonic anhydrase XII |
7440 nM |
Ki |
PMID: 22892213
|
CHEMBL3912 | Q8N1Q1 | Carbonic anhydrase XIII |
8890 nM |
Ki |
PMID: 22892213
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.37% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.42% | 94.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 86.71% | 85.30% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.58% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.50% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.34% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.09% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 85.03% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Boenninghausenia albiflora |
Galipea panamensis |
Leionema coxii |
Micromelum minutum |
Murraya alata |
Murraya paniculata |
Murraya paniculata |
Phebalium filifolium |
Rauia resinosa |
PubChem | 179620 |
NPASS | NPC175159 |
ChEMBL | CHEMBL1098016 |
LOTUS | LTS0059920 |
wikiData | Q72493316 |