2-(4-Methoxyphenyl)-5-prop-1-enyl-1-benzofuran
| Internal ID | 3745354b-54ac-42e8-ac37-3df787db3900 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 2-(4-methoxyphenyl)-5-prop-1-enyl-1-benzofuran |
| SMILES (Canonical) | CC=CC1=CC2=C(C=C1)OC(=C2)C3=CC=C(C=C3)OC |
| SMILES (Isomeric) | CC=CC1=CC2=C(C=C1)OC(=C2)C3=CC=C(C=C3)OC |
| InChI | InChI=1S/C18H16O2/c1-3-4-13-5-10-17-15(11-13)12-18(20-17)14-6-8-16(19-2)9-7-14/h3-12H,1-2H3 |
| InChI Key | LCFUYKXYGSJBDG-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.115029749 g/mol |
| Topological Polar Surface Area (TPSA) | 22.40 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 94.62% | 93.31% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.62% | 96.00% |
| CHEMBL2487 | P05067 | Beta amyloid A4 protein | 93.74% | 96.74% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.31% | 86.33% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.71% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.46% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.59% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.50% | 94.00% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.31% | 87.67% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.60% | 86.92% |
| CHEMBL3959 | P16083 | Quinone reductase 2 | 84.60% | 89.49% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.59% | 95.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.47% | 97.53% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.12% | 90.24% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.95% | 99.15% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.51% | 81.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 82.38% | 92.08% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.31% | 91.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.23% | 90.00% |
| CHEMBL1907599 | P05556 | Integrin alpha-4/beta-1 | 82.22% | 92.86% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.71% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.81% | 98.95% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.05% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Krameria bicolor |
| Krameria erecta |
| Krameria lappacea |
| PubChem | 129650689 |
| LOTUS | LTS0180684 |
| wikiData | Q105149806 |