2-(3,4-Dihydroxyphenyl)-8-beta-D-glucopyranosyl-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one
Internal ID | 8ee7ca12-a842-458c-bc16-095699a9ccd1 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
SMILES (Canonical) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)C4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | COC1=C(C2=C(C(=C1)O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O)C4C(C(C(C(O4)CO)O)O)O |
InChI | InChI=1S/C22H22O11/c1-31-14-6-12(27)16-11(26)5-13(8-2-3-9(24)10(25)4-8)32-21(16)17(14)22-20(30)19(29)18(28)15(7-23)33-22/h2-6,15,18-20,22-25,27-30H,7H2,1H3 |
InChI Key | BRYZTZMVXZZLPD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.67% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.61% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.26% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.64% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.38% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.94% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.73% | 96.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.08% | 86.92% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.52% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.36% | 94.73% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.03% | 85.14% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.82% | 96.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.77% | 97.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.64% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Asphodelus ramosus |
Deschampsia antarctica |
Gnetum gnemon |
Iris florentina |
Passiflora sexflora |
Phragmites australis |
Trollius chinensis |
Trollius ledebourii |
Zantedeschia aethiopica |
PubChem | 73829966 |
LOTUS | LTS0072607 |
wikiData | Q104390746 |