2-[3-Hydroxy-5-[2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 6a7dbeeb-d7da-45ee-beb9-3af286b5b44b |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
IUPAC Name | 2-[3-hydroxy-5-[2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O)O)O |
InChI | InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3 |
InChI Key | GKAJCVFOJGXVIA-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H24O9 |
Molecular Weight | 420.40 g/mol |
Exact Mass | 420.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 149.00 Ų |
XlogP | 0.50 |
NCI60_004004 |
![2D Structure of 2-[3-Hydroxy-5-[2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of 2-[3-Hydroxy-5-[2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/2-3-hydroxy-5-2-3-hydroxy-4-methoxyphenylethenylphenoxy-6-hydroxymethyloxane-345-triol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.68% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.27% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 93.73% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.17% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.85% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.10% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.92% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.04% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 87.86% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.64% | 86.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.96% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.73% | 89.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.21% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.37% | 97.09% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.93% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.55% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Eucalyptus rubida |
Eucalyptus sideroxylon |
Guibourtia tessmannii |
Rheum officinale |
Rheum rhabarbarum |
PubChem | 5062 |
LOTUS | LTS0111863 |
wikiData | Q105009728 |