2-(2-Hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
Internal ID | 8c68c686-d2aa-4fa5-99a9-583ebde9577d |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(2-hydroxyphenyl)-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | C1=CC=C(C(=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
SMILES (Isomeric) | C1=CC=C(C(=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
InChI | InChI=1S/C21H20O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-10-5-6-12-14(24)8-16(29-15(12)7-10)11-3-1-2-4-13(11)23/h1-8,17-23,25-27H,9H2 |
InChI Key | XKKIRVNUMZENAQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O9 |
Molecular Weight | 416.40 g/mol |
Exact Mass | 416.11073221 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.75% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.81% | 91.49% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 97.70% | 83.57% |
CHEMBL2581 | P07339 | Cathepsin D | 96.91% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.09% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.55% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.49% | 94.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.11% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.43% | 97.09% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 87.17% | 95.83% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 87.10% | 96.37% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 86.92% | 96.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.21% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.15% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.94% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.45% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.23% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.20% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Primula auricula |
Primula macrophylla |
PubChem | 74977401 |
LOTUS | LTS0063656 |
wikiData | Q105329518 |