2-(2'-Hydroxy-4'-methoxyphenyl)-5,8-dimethoxy-3-propyl-1h-quinolin-4-one
| Internal ID | 9f48660e-fb28-4980-a247-5fe7eeee0f83 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Phenylquinolines |
| IUPAC Name | 2-(2-hydroxy-4-methoxyphenyl)-5,8-dimethoxy-3-propyl-1H-quinolin-4-one |
| SMILES (Canonical) | CCCC1=C(NC2=C(C=CC(=C2C1=O)OC)OC)C3=C(C=C(C=C3)OC)O |
| SMILES (Isomeric) | CCCC1=C(NC2=C(C=CC(=C2C1=O)OC)OC)C3=C(C=C(C=C3)OC)O |
| InChI | InChI=1S/C21H23NO5/c1-5-6-14-19(13-8-7-12(25-2)11-15(13)23)22-20-17(27-4)10-9-16(26-3)18(20)21(14)24/h7-11,23H,5-6H2,1-4H3,(H,22,24) |
| InChI Key | KRDLFYZITUNBOK-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 77.00 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.07% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.06% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.95% | 86.33% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.42% | 98.59% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.33% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.30% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 93.16% | 93.31% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.31% | 98.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.60% | 91.71% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.77% | 86.92% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.02% | 93.99% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 83.91% | 90.20% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.49% | 93.24% |
| CHEMBL3194 | P02766 | Transthyretin | 82.90% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.67% | 94.75% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.05% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 24766568 |
| NPASS | NPC118418 |
| LOTUS | LTS0171597 |
| wikiData | Q105144939 |