2-(2-Hydroxy-4-methoxyphenyl)-5-(3-hydroxypropyl)benzofuran
Internal ID | d8b15d38-2a8b-4365-a5df-617ff8d5139d |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 2-[5-(3-hydroxypropyl)-1-benzofuran-2-yl]-5-methoxyphenol |
SMILES (Canonical) | COC1=CC(=C(C=C1)C2=CC3=C(O2)C=CC(=C3)CCCO)O |
SMILES (Isomeric) | COC1=CC(=C(C=C1)C2=CC3=C(O2)C=CC(=C3)CCCO)O |
InChI | InChI=1S/C18H18O4/c1-21-14-5-6-15(16(20)11-14)18-10-13-9-12(3-2-8-19)4-7-17(13)22-18/h4-7,9-11,19-20H,2-3,8H2,1H3 |
InChI Key | DZMMGSFVLBBPIA-UHFFFAOYSA-N |
Popularity | 3 references in papers |
Molecular Formula | C18H18O4 |
Molecular Weight | 298.30 g/mol |
Exact Mass | 298.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 62.80 Ų |
XlogP | 3.50 |
CHEBI:69249 |
2-(2-hydroxy-4-methoxyphenyl)-5-(3-hydroxypropyl)benzofuran |
2-[5-(3-hydroxypropyl)-1-benzofuran-2-yl]-5-methoxyphenol |
SCHEMBL17183189 |
BDBM50391889 |
Q27137588 |
2-(2-Hydroxy-4-methoxyphenyl)benzofuran-5-(1-propanol) |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
27200 nM |
IC50 |
PMID: 21800856
|
CHEMBL5658 | O14684 | Prostaglandin E synthase |
42000 nM |
IC50 |
PMID: 21800856
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.93% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.24% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.75% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 94.33% | 86.92% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.06% | 96.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.52% | 96.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.89% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.84% | 99.15% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.22% | 95.93% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.20% | 90.24% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.15% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.91% | 95.56% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 86.67% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 82.96% | 98.35% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.93% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Baliospermum solanifolium |
Caiophora coronata |
Hemsleya graciliflora |
Krameria erecta |
Krameria lappacea |
Nepeta erecta |
Skimmia melanocarpa |
PubChem | 14213211 |
NPASS | NPC39929 |
ChEMBL | CHEMBL2147419 |
LOTUS | LTS0033833 |
wikiData | Q27137588 |