(1R,3S,6S,7S,8S)-3,6,8-trimethyl-2-methylidenetricyclo[5.3.1.03,8]undecane
Internal ID | c61e45bf-45ac-4d01-aa9c-0673efee1339 |
Taxonomy | Hydrocarbons > Unsaturated hydrocarbons > Branched unsaturated hydrocarbons |
IUPAC Name | (1R,3S,6S,7S,8S)-3,6,8-trimethyl-2-methylidenetricyclo[5.3.1.03,8]undecane |
SMILES (Canonical) | CC1CCC2(C(=C)C3CCC2(C1C3)C)C |
SMILES (Isomeric) | C[C@H]1CC[C@]2(C(=C)[C@@H]3CC[C@]2([C@H]1C3)C)C |
InChI | InChI=1S/C15H24/c1-10-5-7-14(3)11(2)12-6-8-15(14,4)13(10)9-12/h10,12-13H,2,5-9H2,1,3-4H3/t10-,12+,13-,14-,15-/m0/s1 |
InChI Key | QQWUXXGYAQMTAT-KLLKFSIISA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H24 |
Molecular Weight | 204.35 g/mol |
Exact Mass | 204.187800766 g/mol |
Topological Polar Surface Area (TPSA) | 0.00 Ų |
XlogP | 5.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.54% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.27% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.84% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.79% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.75% | 100.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.98% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.39% | 91.11% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.94% | 96.43% |
CHEMBL233 | P35372 | Mu opioid receptor | 82.75% | 97.93% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.30% | 94.75% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.14% | 92.94% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 81.94% | 95.38% |
CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.90% | 86.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Persicaria minor |
Toona ciliata |
PubChem | 22211634 |
LOTUS | LTS0055010 |
wikiData | Q105226112 |