(1R,3S)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine
| Internal ID | e803f530-221c-435c-ac4d-4d6e88d4ff43 |
| Taxonomy | Alkaloids and derivatives > Loline alkaloids and derivatives |
| IUPAC Name | (1R,3S)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H14N2O/c1-9-7-6-4-10-3-2-5(11-6)8(7)10/h5-9H,2-4H2,1H3/t5-,6+,7?,8?/m0/s1 |
| InChI Key | OPMNROCQHKJDAQ-JAFIHTMFSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.110613074 g/mol |
| Topological Polar Surface Area (TPSA) | 24.50 Ų |
| XlogP | -0.40 |
| There are no found synonyms. |
![2D Structure of (1R,3S)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine](https://plantaedb.com/storage/docs/compounds/2023/11/1r3s-n-methyl-2-oxa-6-azatricyclo421037nonan-8-amine.jpg "2D Structure of (1R,3S)-N-methyl-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-amine")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 95.29% | 95.58% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.86% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.06% | 96.09% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 90.14% | 94.66% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 88.43% | 92.38% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 85.05% | 98.24% |
| CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 82.98% | 98.99% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.67% | 95.89% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.23% | 97.25% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.75% | 95.83% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 81.55% | 94.78% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 81.40% | 96.31% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.11% | 95.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.78% | 91.03% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 80.73% | 97.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Argyreia mollis |
| Festuca rubra |
| Lolium temulentum |
| PubChem | 145720538 |
| LOTUS | LTS0121314 |
| wikiData | Q104375929 |