[1R-[1alpha,3alpha,4beta]]-4-Ethenyl-alpha,alpha,4-trimethyl-3-[1-methylethenyl]cyclohexanemethanol
Internal ID | 251cbaad-17a9-4031-821b-cb58460cabca |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Elemane sesquiterpenoids |
IUPAC Name | 2-[(1S,3R,4R)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]propan-2-ol |
SMILES (Canonical) | CC(=C)C1CC(CCC1(C)C=C)C(C)(C)O |
SMILES (Isomeric) | CC(=C)[C@H]1C[C@H](CC[C@]1(C)C=C)C(C)(C)O |
InChI | InChI=1S/C15H26O/c1-7-15(6)9-8-12(14(4,5)16)10-13(15)11(2)3/h7,12-13,16H,1-2,8-10H2,3-6H3/t12-,13+,15-/m0/s1 |
InChI Key | GFJIQNADMLPFOW-GUTXKFCHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H26O |
Molecular Weight | 222.37 g/mol |
Exact Mass | 222.198365449 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 4.40 |
[1R-[1.alpha.,3.alpha.,4.beta.]]-4-Ethenyl-.alpha.,.alpha.,4-trimethyl-3-[1-methylethenyl]cyclohexanemethanol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.43% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.00% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.43% | 91.49% |
CHEMBL1871 | P10275 | Androgen Receptor | 92.43% | 96.43% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.63% | 100.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 88.95% | 97.05% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.60% | 92.94% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 87.02% | 91.67% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.47% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.20% | 97.79% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.47% | 97.33% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.88% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.39% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.31% | 96.09% |
CHEMBL3920 | Q04759 | Protein kinase C theta | 82.19% | 97.69% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.16% | 96.95% |
CHEMBL2039 | P27338 | Monoamine oxidase B | 81.70% | 92.51% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 81.53% | 91.03% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 81.12% | 97.31% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.03% | 100.00% |
CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 80.94% | 95.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.32% | 95.89% |
CHEMBL1977 | P11473 | Vitamin D receptor | 80.32% | 99.43% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.30% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.