(1S,2R,4S,5R,8R,10S,13R,14R,18S,20S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacos-16-en-21-one
Internal ID | deab9d3c-daeb-48e0-86ed-4ddc10c341fd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (1S,2R,4S,5R,8R,10S,13R,14R,18S,20S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacos-16-en-21-one |
SMILES (Canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(CO4)OC5C(C(C(C(O5)CO)O)O)OC6C(C(C(CO6)O)O)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)CC=C8C3(CC(C91C8CC(CC9)(C(=O)OC1)C)O)C)C)C |
SMILES (Isomeric) | C[C@@]12CC[C@@]3(COC1=O)[C@@H](C2)C4=CC[C@@H]5[C@]6(CC[C@@H](C([C@@H]6CC[C@]5([C@@]4(C[C@H]3O)C)C)(C)C)O[C@H]7[C@@H]([C@H]([C@H](CO7)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)O)O)O)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C |
InChI | InChI=1S/C52H82O22/c1-47(2)28-9-12-50(5)29(8-7-22-23-15-48(3)13-14-52(23,21-68-46(48)65)30(56)16-51(22,50)6)49(28,4)11-10-31(47)72-44-40(74-43-39(64)36(61)33(58)25(17-53)69-43)35(60)27(20-67-44)71-45-41(37(62)34(59)26(18-54)70-45)73-42-38(63)32(57)24(55)19-66-42/h7,23-45,53-64H,8-21H2,1-6H3/t23-,24+,25+,26+,27-,28-,29+,30+,31-,32-,33+,34+,35-,36-,37-,38+,39+,40+,41+,42-,43-,44-,45-,48-,49-,50+,51+,52+/m0/s1 |
InChI Key | ROPOEQNSKTYTNX-ILUNOZIDSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C52H82O22 |
Molecular Weight | 1059.20 g/mol |
Exact Mass | 1058.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 343.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of (1S,2R,4S,5R,8R,10S,13R,14R,18S,20S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacos-16-en-21-one 2D Structure of (1S,2R,4S,5R,8R,10S,13R,14R,18S,20S)-10-[(2S,3R,4S,5S)-5-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-hydroxy-4,5,9,9,13,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacos-16-en-21-one](https://plantaedb.com/storage/docs/compounds/2023/11/16ba9ec0-868c-11ee-be60-bf6d7f863b6d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.08% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.93% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 93.26% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.39% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.58% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.78% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.69% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.52% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.47% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.33% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.15% | 97.36% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.88% | 97.28% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 87.09% | 90.17% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.86% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.60% | 94.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.45% | 96.43% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.42% | 94.33% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.89% | 97.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.28% | 89.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.55% | 91.07% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.08% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyclamen coum |
Cyclamen repandum |
PubChem | 101944749 |
LOTUS | LTS0211129 |
wikiData | Q105242391 |