1,6-Dihydroxy-7,8-dimethoxyxanthone
| Internal ID | 558c9277-354c-4bd9-8bf2-e770c17ac3fa |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 3,8-dihydroxy-1,2-dimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C(C2=C(C=C1O)OC3=CC=CC(=C3C2=O)O)OC |
| SMILES (Isomeric) | COC1=C(C2=C(C=C1O)OC3=CC=CC(=C3C2=O)O)OC |
| InChI | InChI=1S/C15H12O6/c1-19-14-8(17)6-10-12(15(14)20-2)13(18)11-7(16)4-3-5-9(11)21-10/h3-6,16-17H,1-2H3 |
| InChI Key | WGHXAVBNSLELQQ-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06338810 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 2.70 |
| 1,6-dihydroxy-7,8-dimethoxyxanthone |
| 3,8-Dihydroxy-1,2-dimethoxy-9H-xanthen-9-one |
| 34211-52-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.70% | 93.99% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.59% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.97% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.57% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.68% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.11% | 89.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.08% | 83.82% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.76% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.85% | 94.45% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.95% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.61% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.76% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bonnetia paniculata |
| Calophyllum apetalum |
| Calophyllum brasiliense |
| Calophyllum teysmannii |
| Cratoxylum cochinchinense |
| Polygala nyikensis |
| PubChem | 14630572 |
| LOTUS | LTS0055171 |
| wikiData | Q105304511 |