3-[2-(4-hydroxy-3-methoxyphenyl)-3-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]propyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 4509e4f1-dc07-4966-aa0b-7c5f07812517 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 3-[2-(4-hydroxy-3-methoxyphenyl)-3-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]propyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC2=C1OC(C2COC(=O)C=CC3=CC(=C(C=C3)O)OC)C4=CC(=C(C=C4)O)OC)CCCOC(=O)C=CC5=CC(=C(C=C5)O)OC |
SMILES (Isomeric) | COC1=CC(=CC2=C1OC(C2COC(=O)/C=C/C3=CC(=C(C=C3)O)OC)C4=CC(=C(C=C4)O)OC)CCCOC(=O)/C=C/C5=CC(=C(C=C5)O)OC |
InChI | InChI=1S/C40H40O12/c1-46-33-19-24(7-12-30(33)41)9-15-37(44)50-17-5-6-26-18-28-29(23-51-38(45)16-10-25-8-13-31(42)34(20-25)47-2)39(52-40(28)36(21-26)49-4)27-11-14-32(43)35(22-27)48-3/h7-16,18-22,29,39,41-43H,5-6,17,23H2,1-4H3/b15-9+,16-10+ |
InChI Key | OVFZHMPISOASDF-KAVGSWPWSA-N |
Popularity | 4 references in papers |
Molecular Formula | C40H40O12 |
Molecular Weight | 712.70 g/mol |
Exact Mass | 712.25197671 g/mol |
Topological Polar Surface Area (TPSA) | 159.00 Ų |
XlogP | 6.60 |
CHEMBL4548646 |
57296-22-7 |
CHEBI:70672 |
BDBM50512676 |
AKOS032948221 |
Q27139004 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.93% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.90% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.36% | 99.17% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.21% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.13% | 94.45% |
CHEMBL3194 | P02766 | Transthyretin | 93.86% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.52% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.83% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.63% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.78% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 89.06% | 98.95% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.36% | 80.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.34% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 83.14% | 98.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.03% | 94.73% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.59% | 85.31% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.34% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 81.77% | 97.50% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.28% | 89.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.41% | 92.62% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.21% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hibiscus cannabinus |
Hibiscus taiwanensis |
Ochroma pyramidale |
PubChem | 70698204 |
LOTUS | LTS0207059 |
wikiData | Q27139004 |