10-Hydroxy-1,6,6,9a-tetramethyl-1,2,5a,7,8,9-hexahydronaphtho[1,2-g][1]benzofuran-5,11-dione
| Internal ID | 03116353-68a9-4c84-83b6-0062133a2354 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Oxosteroids |
| IUPAC Name | 10-hydroxy-1,6,6,9a-tetramethyl-1,2,5a,7,8,9-hexahydronaphtho[1,2-g][1]benzofuran-5,11-dione |
| SMILES (Canonical) | CC1COC2=C1C(=O)C(=C3C2=CC(=O)C4C3(CCCC4(C)C)C)O |
| SMILES (Isomeric) | CC1COC2=C1C(=O)C(=C3C2=CC(=O)C4C3(CCCC4(C)C)C)O |
| InChI | InChI=1S/C20H24O4/c1-10-9-24-17-11-8-12(21)18-19(2,3)6-5-7-20(18,4)14(11)16(23)15(22)13(10)17/h8,10,18,23H,5-7,9H2,1-4H3 |
| InChI Key | UGNGMUVRCLLBNO-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
![2D Structure of 10-Hydroxy-1,6,6,9a-tetramethyl-1,2,5a,7,8,9-hexahydronaphtho[1,2-g][1]benzofuran-5,11-dione](https://plantaedb.com/storage/docs/compounds/2023/11/10-hydroxy-1669a-tetramethyl-125a789-hexahydronaphtho12-g1benzofuran-511-dione.jpg "2D Structure of 10-Hydroxy-1,6,6,9a-tetramethyl-1,2,5a,7,8,9-hexahydronaphtho[1,2-g][1]benzofuran-5,11-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.37% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.77% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.13% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.72% | 95.56% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 89.18% | 86.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.73% | 100.00% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 84.43% | 94.78% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 82.92% | 96.77% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.68% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.34% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.11% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.84% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.47% | 93.40% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.46% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coleus lanuginosus |
| Salvia apiana |
| PubChem | 73832790 |
| LOTUS | LTS0203710 |
| wikiData | Q104401997 |