1-Propanesulfinothioic acid, S-propyl ester
| Internal ID | 5e48191d-3573-4d2b-a379-bced0b2a6799 |
| Taxonomy | Organic acids and derivatives > Thiosulfinic acid esters |
| IUPAC Name | 1-propylsulfinylsulfanylpropane |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C6H14OS2/c1-3-5-8-9(7)6-4-2/h3-6H2,1-2H3 |
| InChI Key | XPRZAEWSYWTDSQ-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C6H14OS2 |
| Molecular Weight | 166.30 g/mol |
| Exact Mass | 166.04860741 g/mol |
| Topological Polar Surface Area (TPSA) | 61.60 Ų |
| XlogP | 1.60 |
| EINECS 217-755-9 |
| NSC 23131 |
| RefChem:436120 |
| 1948-52-3 |
| s-propyl propane-1-sulfinothioate |
| 1-propylsulfinylsulfanylpropane |
| S-Propyl 1-propanesulfinothioate |
| S-Propyl propane-1-thiosulfinate |
| S-Propyl propane-1-thiosulphinate |
| S-propyl propanethiosulfinate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL4072 | P07858 | Cathepsin B |
15600 nM |
Ki |
PMID: 20692829
|
| CHEMBL3837 | P07711 | Cathepsin L |
11300 nM |
Ki |
PMID: 20692829
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.66% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.46% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.99% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium cepa |
| Allium schoenoprasum |
| Mimosa pudica |
| PubChem | 74761 |
| NPASS | NPC326758 |
| ChEMBL | CHEMBL1224166 |
| LOTUS | LTS0032930 |
| wikiData | Q27163023 |