1-Methylpyrrolidine-2-carboxylic acid
| Internal ID | 3df3cbe0-d7cb-468f-95ff-6410a431bdc0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Proline and derivatives |
| IUPAC Name | 1-methylpyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CN1CCCC1C(=O)O |
| SMILES (Isomeric) | CN1CCCC1C(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9) |
| InChI Key | CWLQUGTUXBXTLF-UHFFFAOYSA-N |
| Popularity | 49 references in papers |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.078978594 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | -1.90 |
| 68078-09-1 |
| 1-Methyl-pyrrolidine-2-carboxylic acid |
| 1-Methyl-DL-proline |
| N-Me-Pro-OH |
| N-methylproline |
| methylproline |
| D-Proline, 1-methyl- |
| L-Proline, 1-methyl- |
| proline, 1-methyl- |
| MFCD00011565 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.69% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.64% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.26% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.87% | 98.95% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 85.36% | 98.77% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.71% | 98.46% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.02% | 99.18% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 83.15% | 98.24% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.00% | 93.04% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.54% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.38% | 90.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.35% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Casimiroa edulis |
| Tamarix parviflora |
| Trichilia claussenii |
| PubChem | 557 |
| LOTUS | LTS0230271 |
| wikiData | Q3596761 |