1-Hydroxy-3,5,8-trimethoxyxanthen-9-one
| Internal ID | bea99339-af2c-4c27-a761-b64d085d5477 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
| IUPAC Name | 1-hydroxy-3,5,8-trimethoxyxanthen-9-one |
| SMILES (Canonical) | COC1=C2C(=C(C=C1)OC)OC3=CC(=CC(=C3C2=O)O)OC |
| SMILES (Isomeric) | COC1=C2C(=C(C=C1)OC)OC3=CC(=CC(=C3C2=O)O)OC |
| InChI | InChI=1S/C16H14O6/c1-19-8-6-9(17)13-12(7-8)22-16-11(21-3)5-4-10(20-2)14(16)15(13)18/h4-7,17H,1-3H3 |
| InChI Key | WSRRHFFQNVXIKF-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07903816 g/mol |
| Topological Polar Surface Area (TPSA) | 74.20 Ų |
| XlogP | 3.10 |
| 1-Hydroxy-3,5,8-trimethoxyxanthen-9-one |
| 49599-09-9 |
| Xanthen-9-one, 1-hydroxy-3,5,8-trimethoxy- |
| BRN 0315646 |
| DTXSID30197917 |
| WSRRHFFQNVXIKF-UHFFFAOYSA-N |
| 1-hydroxy-3,5,8-trimethoxyxanthone |
| 1-Hydroxy-3,5,8-trimethoxy-9H-xanthen-9-one # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.15% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.91% | 94.00% |
| CHEMBL3194 | P02766 | Transthyretin | 91.87% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.43% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.16% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.49% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.10% | 89.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.78% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.51% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.29% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.08% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.27% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.96% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.42% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.39% | 93.99% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.75% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Centaurium littorale |
| Lomatogonium carinthiacum |
| Schenkia spicata |
| Swertia chirayta |
| PubChem | 5378285 |
| LOTUS | LTS0226256 |
| wikiData | Q83070681 |